C18H21N5O6 — CID 29159555
ethyl (4S,5S)-2-(4-formylpiperazin-1-yl)-4-(4-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 29159555) has the molecular formula C18H21N5O6 and a molecular weight of 403.40 g/mol. Its IUPAC name is ethyl (4S,5S)-2-(4-formylpiperazin-1-yl)-4-(4-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S,5S)-2-(4-formylpiperazin-1-yl)-4-(4-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 29159555 |
| Molecular Formula | C18H21N5O6 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | ethyl (4S,5S)-2-(4-formylpiperazin-1-yl)-4-(4-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)NC(N2CCN(C=O)CC2)=N[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H21N5O6/c1-2-29-17(26)14-15(12-3-5-13(6-4-12)23(27)28)19-18(20-16(14)25)22-9-7-21(11-24)8-10-22/h3-6,11,14-15H,2,7-10H2,1H3,(H,19,20,25)/t14-,15+/m0/s1 |
| InChIKey | QNVNDDRJGAMRFG-LSDHHAIUSA-N |
| XLogP | 0.08 |
| TPSA | 134.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|