C21H23N7O5 — CID 41111304
ethyl (4R,5R)-4-(4-nitrophenyl)-6-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)-4,5-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 41111304) has the molecular formula C21H23N7O5 and a molecular weight of 453.46 g/mol. Its IUPAC name is ethyl (4R,5R)-4-(4-nitrophenyl)-6-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)-4,5-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R,5R)-4-(4-nitrophenyl)-6-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)-4,5-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 41111304 |
| Molecular Formula | C21H23N7O5 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | ethyl (4R,5R)-4-(4-nitrophenyl)-6-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)NC(N2CCN(c3ncccn3)CC2)=N[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H23N7O5/c1-2-33-19(30)16-17(14-4-6-15(7-5-14)28(31)32)24-21(25-18(16)29)27-12-10-26(11-13-27)20-22-8-3-9-23-20/h3-9,16-17H,2,10-13H2,1H3,(H,24,25,29)/t16-,17+/m1/s1 |
| InChIKey | DNEOXRZKFAPMPA-SJORKVTESA-N |
| XLogP | 0.91 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|