C22H24N6O5 — CID 27863744
ethyl (4S,5R)-4-(3-nitrophenyl)-6-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)-4,5-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 27863744) has the molecular formula C22H24N6O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is ethyl (4S,5R)-4-(3-nitrophenyl)-6-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)-4,5-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S,5R)-4-(3-nitrophenyl)-6-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)-4,5-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 27863744 |
| Molecular Formula | C22H24N6O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | ethyl (4S,5R)-4-(3-nitrophenyl)-6-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)NC(N2CCN(c3ccccn3)CC2)=N[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24N6O5/c1-2-33-21(30)18-19(15-6-5-7-16(14-15)28(31)32)24-22(25-20(18)29)27-12-10-26(11-13-27)17-8-3-4-9-23-17/h3-9,14,18-19H,2,10-13H2,1H3,(H,24,25,29)/t18-,19-/m1/s1 |
| InChIKey | CZPTUZWSRIRELH-RTBURBONSA-N |
| XLogP | 1.52 |
| TPSA | 130.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|