C20H25N5O7 — CID 29110583
ethyl (4S,5S)-2-(4-ethoxycarbonylpiperazin-1-yl)-4-(3-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 29110583) has the molecular formula C20H25N5O7 and a molecular weight of 447.45 g/mol. Its IUPAC name is ethyl (4S,5S)-2-(4-ethoxycarbonylpiperazin-1-yl)-4-(3-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S,5S)-2-(4-ethoxycarbonylpiperazin-1-yl)-4-(3-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 29110583 |
| Molecular Formula | C20H25N5O7 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | ethyl (4S,5S)-2-(4-ethoxycarbonylpiperazin-1-yl)-4-(3-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)NC(N2CCN(C(=O)OCC)CC2)=N[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H25N5O7/c1-3-31-18(27)15-16(13-6-5-7-14(12-13)25(29)30)21-19(22-17(15)26)23-8-10-24(11-9-23)20(28)32-4-2/h5-7,12,15-16H,3-4,8-11H2,1-2H3,(H,21,22,26)/t15-,16+/m0/s1 |
| InChIKey | BRNPWFMQYZEMNX-JKSUJKDBSA-N |
| XLogP | 1.08 |
| TPSA | 143.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|