C20H25ClN4O5 — CID 27825444
ethyl (4R,5S)-4-(4-chlorophenyl)-2-(4-ethoxycarbonylpiperazin-1-yl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 27825444) has the molecular formula C20H25ClN4O5 and a molecular weight of 436.90 g/mol. Its IUPAC name is ethyl (4R,5S)-4-(4-chlorophenyl)-2-(4-ethoxycarbonylpiperazin-1-yl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R,5S)-4-(4-chlorophenyl)-2-(4-ethoxycarbonylpiperazin-1-yl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 27825444 |
| Molecular Formula | C20H25ClN4O5 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | ethyl (4R,5S)-4-(4-chlorophenyl)-2-(4-ethoxycarbonylpiperazin-1-yl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)NC(N2CCN(C(=O)OCC)CC2)=N[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H25ClN4O5/c1-3-29-18(27)15-16(13-5-7-14(21)8-6-13)22-19(23-17(15)26)24-9-11-25(12-10-24)20(28)30-4-2/h5-8,15-16H,3-4,9-12H2,1-2H3,(H,22,23,26)/t15-,16-/m0/s1 |
| InChIKey | BHXUCWXFUBANPW-HOTGVXAUSA-N |
| XLogP | 1.82 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|