C17H18Cl2O4 — CID 25426402
ethyl (1S,2S,4S)-2-(2,2-dichloroethenyl)-4-hydroxy-6-oxo-4-phenylcyclohexane-1-carboxylate (PubChem CID 25426402) has the molecular formula C17H18Cl2O4 and a molecular weight of 357.23 g/mol. Its IUPAC name is ethyl (1S,2S,4S)-2-(2,2-dichloroethenyl)-4-hydroxy-6-oxo-4-phenylcyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2S,4S)-2-(2,2-dichloroethenyl)-4-hydroxy-6-oxo-4-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 25426402 |
| Molecular Formula | C17H18Cl2O4 |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | ethyl (1S,2S,4S)-2-(2,2-dichloroethenyl)-4-hydroxy-6-oxo-4-phenylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C[C@](O)(c2ccccc2)C[C@@H]1C=C(Cl)Cl |
| InChI | InChI=1S/C17H18Cl2O4/c1-2-23-16(21)15-11(8-14(18)19)9-17(22,10-13(15)20)12-6-4-3-5-7-12/h3-8,11,15,22H,2,9-10H2,1H3/t11-,15-,17-/m0/s1 |
| InChIKey | MLKPLBAELXSACH-KCTSRDHCSA-N |
| XLogP | 3.35 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|