C14H19NO2 — CID 97357628
ethyl (3R,4R)-4-methyl-4-phenylpyrrolidine-3-carboxylate (PubChem CID 97357628) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is ethyl (3R,4R)-4-methyl-4-phenylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R,4R)-4-methyl-4-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 97357628 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | ethyl (3R,4R)-4-methyl-4-phenylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CNC[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-3-17-13(16)12-9-15-10-14(12,2)11-7-5-4-6-8-11/h4-8,12,15H,3,9-10H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | ZZDBUIZTYKSKSH-OCCSQVGLSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |