C13H16N2O3S — CID 10967911
ethyl 4-hydroxy-4-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate (PubChem CID 10967911) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl 4-hydroxy-4-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 10967911 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | ethyl 4-hydroxy-4-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxylate |
| SMILES | CCOC(=O)C1CNC(=S)NC1(O)c1ccccc1 |
| InChI | InChI=1S/C13H16N2O3S/c1-2-18-11(16)10-8-14-12(19)15-13(10,17)9-6-4-3-5-7-9/h3-7,10,17H,2,8H2,1H3,(H2,14,15,19) |
| InChIKey | WDFFRORURSKJRC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|