C13H18N2O2 — CID 114486700
ethyl 4-methyl-4-pyridin-4-ylpyrrolidine-3-carboxylate (PubChem CID 114486700) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is ethyl 4-methyl-4-pyridin-4-ylpyrrolidine-3-carboxylate.
| Compound Name | ethyl 4-methyl-4-pyridin-4-ylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 114486700 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | ethyl 4-methyl-4-pyridin-4-ylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CNCC1(C)c1ccncc1 |
| InChI | InChI=1S/C13H18N2O2/c1-3-17-12(16)11-8-15-9-13(11,2)10-4-6-14-7-5-10/h4-7,11,15H,3,8-9H2,1-2H3 |
| InChIKey | PLWJHHJPKBDGEP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |