About ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate
ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate (PubChem CID 170756026) has the molecular formula C13H18N4O2
and a molecular weight of 262.31 g/mol. Its IUPAC name is ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate |
| PubChem CID | 170756026 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate |
| SMILES | CCOC(=O)C1CNCC12CN(c1ncccn1)C2 |
| InChI | InChI=1S/C13H18N4O2/c1-2-19-11(18)10-6-14-7-13(10)8-17(9-13)12-15-4-3-5-16-12/h3-5,10,14H,2,6-9H2,1H3 |
| InChIKey | CPEGZWHZRUDFTB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate?
The IUPAC name of ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate (CID 170756026) is ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate.
What is the SMILES notation for ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate?
The canonical SMILES for ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate is CCOC(=O)C1CNCC12CN(c1ncccn1)C2.
What is the InChIKey of ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate?
The InChIKey is CPEGZWHZRUDFTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2/c1-2-19-11(18)10-6-14-7-13(10)8-17(9-13)12-15-4-3-5-16-12/h3-5,10,14H,2,6-9H2,1H3.
What are the key properties of ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate?
ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate has a molecular weight of 262.31 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-pyrimidin-2-yl-2,7-diazaspiro[3.4]octane-5-carboxylate is sourced from PubChem (CID 170756026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).