C14H18O3 — CID 15806625
methyl (1R,3R,4S)-4-hydroxy-3-phenylcyclohexane-1-carboxylate (PubChem CID 15806625) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is methyl (1R,3R,4S)-4-hydroxy-3-phenylcyclohexane-1-carboxylate.
| Compound Name | methyl (1R,3R,4S)-4-hydroxy-3-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 15806625 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | methyl (1R,3R,4S)-4-hydroxy-3-phenylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H](O)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C14H18O3/c1-17-14(16)11-7-8-13(15)12(9-11)10-5-3-2-4-6-10/h2-6,11-13,15H,7-9H2,1H3/t11-,12-,13+/m1/s1 |
| InChIKey | LRWOHBTZIVZOBS-UPJWGTAASA-N |
| XLogP | 2.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |