C18H20O8 — CID 90110997
2,2,4,4,5,5-hexaacetylcyclohexane-1,3-dione (PubChem CID 90110997) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is 2,2,4,4,5,5-hexaacetylcyclohexane-1,3-dione.
| Compound Name | 2,2,4,4,5,5-hexaacetylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 90110997 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2,2,4,4,5,5-hexaacetylcyclohexane-1,3-dione |
| SMILES | CC(=O)C1(C(C)=O)C(=O)CC(C(C)=O)(C(C)=O)C(C(C)=O)(C(C)=O)C1=O |
| InChI | InChI=1S/C18H20O8/c1-8(19)16(9(2)20)7-14(25)17(10(3)21,11(4)22)15(26)18(16,12(5)23)13(6)24/h7H2,1-6H3 |
| InChIKey | CYWAKEAMXPZRDG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|