C18H18O9 — CID 140639949
3,3,5,5,6,6-hexaacetylcyclohexane-1,2,4-trione (PubChem CID 140639949) has the molecular formula C18H18O9 and a molecular weight of 378.33 g/mol. Its IUPAC name is 3,3,5,5,6,6-hexaacetylcyclohexane-1,2,4-trione.
| Compound Name | 3,3,5,5,6,6-hexaacetylcyclohexane-1,2,4-trione |
|---|---|
| PubChem CID | 140639949 |
| Molecular Formula | C18H18O9 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3,3,5,5,6,6-hexaacetylcyclohexane-1,2,4-trione |
| SMILES | CC(=O)C1(C(C)=O)C(=O)C(=O)C(C(C)=O)(C(C)=O)C(C(C)=O)(C(C)=O)C1=O |
| InChI | InChI=1S/C18H18O9/c1-7(19)16(8(2)20)13(25)14(26)17(9(3)21,10(4)22)18(11(5)23,12(6)24)15(16)27/h1-6H3 |
| InChIKey | KIMODOAAUQKUOE-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 153.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|