C8H9NO5 — CID 141086126
3,4-diacetyl-1-hydroxypyrrolidine-2,5-dione (PubChem CID 141086126) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is 3,4-diacetyl-1-hydroxypyrrolidine-2,5-dione.
| Compound Name | 3,4-diacetyl-1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 141086126 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 3,4-diacetyl-1-hydroxypyrrolidine-2,5-dione |
| SMILES | CC(=O)C1C(=O)N(O)C(=O)C1C(C)=O |
| InChI | InChI=1S/C8H9NO5/c1-3(10)5-6(4(2)11)8(13)9(14)7(5)12/h5-6,14H,1-2H3 |
| InChIKey | JAPZVZYHKJCVHY-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|