C17H33NO2Si2 — CID 101372642
3-acetyl-1-[bis(trimethylsilyl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one (PubChem CID 101372642) has the molecular formula C17H33NO2Si2 and a molecular weight of 339.63 g/mol. Its IUPAC name is 3-acetyl-1-[bis(trimethylsilyl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one.
| Compound Name | 3-acetyl-1-[bis(trimethylsilyl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
|---|---|
| PubChem CID | 101372642 |
| Molecular Formula | C17H33NO2Si2 |
| Molecular Weight | 339.63 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 3-acetyl-1-[bis(trimethylsilyl)methyl]-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
| SMILES | CC(=O)C1C(=O)N(C([Si](C)(C)C)[Si](C)(C)C)C2CCCCC12 |
| InChI | InChI=1S/C17H33NO2Si2/c1-12(19)15-13-10-8-9-11-14(13)18(16(15)20)17(21(2,3)4)22(5,6)7/h13-15,17H,8-11H2,1-7H3 |
| InChIKey | OSXNMWRCOBAPSH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|