C18H28N2OS — CID 100898365
[(4S,4aS,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone (PubChem CID 100898365) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is [(4S,4aS,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone.
| Compound Name | [(4S,4aS,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 100898365 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | [(4S,4aS,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1nc(C(C)C)sc1C(=O)N1CC[C@H](C)[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H28N2OS/c1-11(2)17-19-13(4)16(22-17)18(21)20-10-9-12(3)14-7-5-6-8-15(14)20/h11-12,14-15H,5-10H2,1-4H3/t12-,14-,15+/m0/s1 |
| InChIKey | NTWAQBGTIRPLSJ-AEGPPILISA-N |
| XLogP | 4.62 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |