About [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone
[(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone (PubChem CID 97123080) has the molecular formula C11H16N2O3S
and a molecular weight of 256.33 g/mol. Its IUPAC name is [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone.
Molecular Properties
| Compound Name | [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone |
| PubChem CID | 97123080 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1nc(C(C)C)sc1C(=O)N1C[C@H](O)CO1 |
| InChI | InChI=1S/C11H16N2O3S/c1-6(2)10-12-7(3)9(17-10)11(15)13-4-8(14)5-16-13/h6,8,14H,4-5H2,1-3H3/t8-/m0/s1 |
| InChIKey | XSXUHMVVNDJPTQ-QMMMGPOBSA-N |
| XLogP | 1.32 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone?
The IUPAC name of [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone (CID 97123080) is [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone.
What is the SMILES notation for [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone?
The canonical SMILES for [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone is Cc1nc(C(C)C)sc1C(=O)N1C[C@H](O)CO1.
What is the InChIKey of [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone?
The InChIKey is XSXUHMVVNDJPTQ-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H16N2O3S/c1-6(2)10-12-7(3)9(17-10)11(15)13-4-8(14)5-16-13/h6,8,14H,4-5H2,1-3H3/t8-/m0/s1.
What are the key properties of [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone?
[(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone has a molecular weight of 256.33 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-4-hydroxy-1,2-oxazolidin-2-yl]-(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methanone is sourced from PubChem (CID 97123080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).