C11H14O2 — CID 138965004
(3aR,4R,7aS)-4-acetyl-1,2,3,3a,4,7a-hexahydroinden-5-one (PubChem CID 138965004) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-acetyl-1,2,3,3a,4,7a-hexahydroinden-5-one.
| Compound Name | (3aR,4R,7aS)-4-acetyl-1,2,3,3a,4,7a-hexahydroinden-5-one |
|---|---|
| PubChem CID | 138965004 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (3aR,4R,7aS)-4-acetyl-1,2,3,3a,4,7a-hexahydroinden-5-one |
| SMILES | CC(=O)[C@@H]1C(=O)C=C[C@@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C11H14O2/c1-7(12)11-9-4-2-3-8(9)5-6-10(11)13/h5-6,8-9,11H,2-4H2,1H3/t8-,9+,11-/m0/s1 |
| InChIKey | WUSBSMQUTFWTJH-NGZCFLSTSA-N |
| XLogP | 1.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|