C15H17NO — CID 556660
N-phenyl-1,3a,4,5,6,6a-hexahydropentalene-1-carboxamide (PubChem CID 556660) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is N-phenyl-1,3a,4,5,6,6a-hexahydropentalene-1-carboxamide.
| Compound Name | N-phenyl-1,3a,4,5,6,6a-hexahydropentalene-1-carboxamide |
|---|---|
| PubChem CID | 556660 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-phenyl-1,3a,4,5,6,6a-hexahydropentalene-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1C=CC2CCCC21 |
| InChI | InChI=1S/C15H17NO/c17-15(16-12-6-2-1-3-7-12)14-10-9-11-5-4-8-13(11)14/h1-3,6-7,9-11,13-14H,4-5,8H2,(H,16,17) |
| InChIKey | NSBQDWCYCTVJKE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|