C12H16N2O3 — CID 12710759
3,5-diacetyl-3,5-diazatricyclo[5.3.0.02,6]decan-4-one (PubChem CID 12710759) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3,5-diacetyl-3,5-diazatricyclo[5.3.0.02,6]decan-4-one.
| Compound Name | 3,5-diacetyl-3,5-diazatricyclo[5.3.0.02,6]decan-4-one |
|---|---|
| PubChem CID | 12710759 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3,5-diacetyl-3,5-diazatricyclo[5.3.0.02,6]decan-4-one |
| SMILES | CC(=O)N1C(=O)N(C(C)=O)C2C3CCCC3C21 |
| InChI | InChI=1S/C12H16N2O3/c1-6(15)13-10-8-4-3-5-9(8)11(10)14(7(2)16)12(13)17/h8-11H,3-5H2,1-2H3 |
| InChIKey | JDKNOOOXZKFVPC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |