C10H14N4O4 — CID 832248
(3aR,6aR)-3,6-diacetyl-1,4-dimethyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 832248) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is (3aR,6aR)-3,6-diacetyl-1,4-dimethyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | (3aR,6aR)-3,6-diacetyl-1,4-dimethyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 832248 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (3aR,6aR)-3,6-diacetyl-1,4-dimethyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | CC(=O)N1C(=O)N(C)[C@H]2[C@@H]1N(C)C(=O)N2C(C)=O |
| InChI | InChI=1S/C10H14N4O4/c1-5(15)13-7-8(12(4)9(13)17)14(6(2)16)10(18)11(7)3/h7-8H,1-4H3/t7-,8-/m1/s1 |
| InChIKey | PTCRLTDUDNUBEP-HTQZYQBOSA-N |
| XLogP | -0.53 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |