C8H14N2O — CID 141071074
1-(2,3,5-trimethyl-2H-imidazol-1-yl)ethanone (PubChem CID 141071074) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-(2,3,5-trimethyl-2H-imidazol-1-yl)ethanone.
| Compound Name | 1-(2,3,5-trimethyl-2H-imidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 141071074 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-(2,3,5-trimethyl-2H-imidazol-1-yl)ethanone |
| SMILES | CC(=O)N1C(C)=CN(C)C1C |
| InChI | InChI=1S/C8H14N2O/c1-6-5-9(4)7(2)10(6)8(3)11/h5,7H,1-4H3 |
| InChIKey | RIEZQBBKTNFMMI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |