C7H12N2O — CID 59571529
3-ethyl-1,4-dimethylimidazol-2-one (PubChem CID 59571529) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 3-ethyl-1,4-dimethylimidazol-2-one.
| Compound Name | 3-ethyl-1,4-dimethylimidazol-2-one |
|---|---|
| PubChem CID | 59571529 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 3-ethyl-1,4-dimethylimidazol-2-one |
| SMILES | CCn1c(C)cn(C)c1=O |
| InChI | InChI=1S/C7H12N2O/c1-4-9-6(2)5-8(3)7(9)10/h5H,4H2,1-3H3 |
| InChIKey | BFYMKDPVVJAZLE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |