C8H14N4O5 — CID 1254938
(3aS,6aR)-3,4,6-tris(hydroxymethyl)-1-methyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 1254938) has the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. Its IUPAC name is (3aS,6aR)-3,4,6-tris(hydroxymethyl)-1-methyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | (3aS,6aR)-3,4,6-tris(hydroxymethyl)-1-methyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 1254938 |
| Molecular Formula | C8H14N4O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (3aS,6aR)-3,4,6-tris(hydroxymethyl)-1-methyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | CN1C(=O)N(CO)[C@@H]2[C@H]1N(CO)C(=O)N2CO |
| InChI | InChI=1S/C8H14N4O5/c1-9-5-6(11(3-14)7(9)16)12(4-15)8(17)10(5)2-13/h5-6,13-15H,2-4H2,1H3/t5-,6+/m1/s1 |
| InChIKey | AAUFEYGCXLUQBU-RITPCOANSA-N |
| XLogP | -2.41 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |