C15H26N2O3 — CID 101119809
(4R,5R)-1,3-diacetyl-4,5-ditert-butylimidazolidin-2-one (PubChem CID 101119809) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is (4R,5R)-1,3-diacetyl-4,5-ditert-butylimidazolidin-2-one.
| Compound Name | (4R,5R)-1,3-diacetyl-4,5-ditert-butylimidazolidin-2-one |
|---|---|
| PubChem CID | 101119809 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (4R,5R)-1,3-diacetyl-4,5-ditert-butylimidazolidin-2-one |
| SMILES | CC(=O)N1C(=O)N(C(C)=O)[C@H](C(C)(C)C)[C@H]1C(C)(C)C |
| InChI | InChI=1S/C15H26N2O3/c1-9(18)16-11(14(3,4)5)12(15(6,7)8)17(10(2)19)13(16)20/h11-12H,1-8H3/t11-,12-/m0/s1 |
| InChIKey | ONWZAHNKHMWPGR-RYUDHWBXSA-N |
| XLogP | 2.65 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |