C10H18N2O3 — CID 101119798
(4S,5S)-1-acetyl-4-tert-butyl-5-methoxyimidazolidin-2-one (PubChem CID 101119798) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is (4S,5S)-1-acetyl-4-tert-butyl-5-methoxyimidazolidin-2-one.
| Compound Name | (4S,5S)-1-acetyl-4-tert-butyl-5-methoxyimidazolidin-2-one |
|---|---|
| PubChem CID | 101119798 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | (4S,5S)-1-acetyl-4-tert-butyl-5-methoxyimidazolidin-2-one |
| SMILES | CO[C@H]1[C@H](C(C)(C)C)NC(=O)N1C(C)=O |
| InChI | InChI=1S/C10H18N2O3/c1-6(13)12-8(15-5)7(10(2,3)4)11-9(12)14/h7-8H,1-5H3,(H,11,14)/t7-,8+/m1/s1 |
| InChIKey | ZUFGNZLBUBMTCW-SFYZADRCSA-N |
| XLogP | 0.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |