C8H15NO3 — CID 45091148
(4S,5R)-4-tert-butyl-5-methoxy-1,3-oxazolidin-2-one (PubChem CID 45091148) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (4S,5R)-4-tert-butyl-5-methoxy-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-4-tert-butyl-5-methoxy-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 45091148 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (4S,5R)-4-tert-butyl-5-methoxy-1,3-oxazolidin-2-one |
| SMILES | CO[C@@H]1OC(=O)N[C@H]1C(C)(C)C |
| InChI | InChI=1S/C8H15NO3/c1-8(2,3)5-6(11-4)12-7(10)9-5/h5-6H,1-4H3,(H,9,10)/t5-,6-/m1/s1 |
| InChIKey | NXJGCBBUBBIDJU-PHDIDXHHSA-N |
| XLogP | 1.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |