C10H14N6O4 — CID 95987832
(1R,3S,7R,9R)-2,8-diacetyl-2,4,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodecane-5,11-dione (PubChem CID 95987832) has the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is (1R,3S,7R,9R)-2,8-diacetyl-2,4,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodecane-5,11-dione.
| Compound Name | (1R,3S,7R,9R)-2,8-diacetyl-2,4,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodecane-5,11-dione |
|---|---|
| PubChem CID | 95987832 |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (1R,3S,7R,9R)-2,8-diacetyl-2,4,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodecane-5,11-dione |
| SMILES | CC(=O)N1[C@@H]2NC(=O)N[C@@H]2N(C(C)=O)[C@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C10H14N6O4/c1-3(17)15-5-7(13-9(19)11-5)16(4(2)18)8-6(15)12-10(20)14-8/h5-8H,1-2H3,(H2,11,13,19)(H2,12,14,20)/t5-,6-,7-,8+/m1/s1 |
| InChIKey | ICTSIWFUTMWKPE-XUTVFYLZSA-N |
| XLogP | -2.37 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |