C10H21NO — CID 145255131
1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]ethanone;ethane (PubChem CID 145255131) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is 1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]ethanone;ethane.
| Compound Name | 1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]ethanone;ethane |
|---|---|
| PubChem CID | 145255131 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]ethanone;ethane |
| SMILES | CC.CC(=O)N1[C@H](C)CC[C@H]1C |
| InChI | InChI=1S/C8H15NO.C2H6/c1-6-4-5-7(2)9(6)8(3)10;1-2/h6-7H,4-5H2,1-3H3;1-2H3/t6-,7-;/m1./s1 |
| InChIKey | IEYYYKARXPXLLX-ZJLYAJKPSA-N |
| XLogP | 2.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |