C8H16N2O — CID 143550985
1-[(2R)-2,6-dimethylpiperazin-1-yl]ethanone (PubChem CID 143550985) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-[(2R)-2,6-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2,6-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143550985 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1-[(2R)-2,6-dimethylpiperazin-1-yl]ethanone |
| SMILES | CC(=O)N1C(C)CNC[C@H]1C |
| InChI | InChI=1S/C8H16N2O/c1-6-4-9-5-7(2)10(6)8(3)11/h6-7,9H,4-5H2,1-3H3/t6-,7?/m1/s1 |
| InChIKey | GMIYNBYIVKBBTO-ULUSZKPHSA-N |
| XLogP | 0.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |