About 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one
1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one (PubChem CID 115737245) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one.
Molecular Properties
| Compound Name | 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one |
| PubChem CID | 115737245 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one |
| SMILES | COC(C)C(=O)N1C(C)CNCC1C |
| InChI | InChI=1S/C10H20N2O2/c1-7-5-11-6-8(2)12(7)10(13)9(3)14-4/h7-9,11H,5-6H2,1-4H3 |
| InChIKey | ZNSQGRKWVPTXRZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one?
The IUPAC name of 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one (CID 115737245) is 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one.
What is the SMILES notation for 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one?
The canonical SMILES for 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one is COC(C)C(=O)N1C(C)CNCC1C.
What is the InChIKey of 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one?
The InChIKey is ZNSQGRKWVPTXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-7-5-11-6-8(2)12(7)10(13)9(3)14-4/h7-9,11H,5-6H2,1-4H3.
What are the key properties of 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one?
1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one has a molecular weight of 200.28 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylpiperazin-1-yl)-2-methoxypropan-1-one is sourced from PubChem (CID 115737245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).