C9H18N2O4 — CID 155903876
oxalic acid;(2R,6S)-1,2,6-trimethylpiperazine (PubChem CID 155903876) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is oxalic acid;(2R,6S)-1,2,6-trimethylpiperazine.
| Compound Name | oxalic acid;(2R,6S)-1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 155903876 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | oxalic acid;(2R,6S)-1,2,6-trimethylpiperazine |
| SMILES | C[C@@H]1CNC[C@H](C)N1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C7H16N2.C2H2O4/c1-6-4-8-5-7(2)9(6)3;3-1(4)2(5)6/h6-8H,4-5H2,1-3H3;(H,3,4)(H,5,6)/t6-,7+; |
| InChIKey | ZDJSGZNHMWLSJU-UKMDXRBESA-N |
| XLogP | -0.55 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|