C6H14N2S — CID 142071790
1,6-dimethylpiperazine-2-thiol (PubChem CID 142071790) has the molecular formula C6H14N2S and a molecular weight of 146.26 g/mol. Its IUPAC name is 1,6-dimethylpiperazine-2-thiol.
| Compound Name | 1,6-dimethylpiperazine-2-thiol |
|---|---|
| PubChem CID | 142071790 |
| Molecular Formula | C6H14N2S |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 1,6-dimethylpiperazine-2-thiol |
| SMILES | CC1CNCC(S)N1C |
| InChI | InChI=1S/C6H14N2S/c1-5-3-7-4-6(9)8(5)2/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | HUNLYLVORADROU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|