C9H21ClN2 — CID 130710519
(2S,6R)-2,6-dimethyl-1-propylpiperazine;hydrochloride (PubChem CID 130710519) has the molecular formula C9H21ClN2 and a molecular weight of 192.73 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-1-propylpiperazine;hydrochloride.
| Compound Name | (2S,6R)-2,6-dimethyl-1-propylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 130710519 |
| Molecular Formula | C9H21ClN2 |
| Molecular Weight | 192.73 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-1-propylpiperazine;hydrochloride |
| SMILES | CCCN1[C@H](C)CNC[C@@H]1C.Cl |
| InChI | InChI=1S/C9H20N2.ClH/c1-4-5-11-8(2)6-10-7-9(11)3;/h8-10H,4-7H2,1-3H3;1H/t8-,9+; |
| InChIKey | FQJJIKRZWUYOGP-UFIFRZAQSA-N |
| XLogP | 1.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.73 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |