C12H26N2O2S — CID 103815489
1-(2-tert-butylsulfonylethyl)-2,6-dimethylpiperazine (PubChem CID 103815489) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-2,6-dimethylpiperazine.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-2,6-dimethylpiperazine |
|---|---|
| PubChem CID | 103815489 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-2,6-dimethylpiperazine |
| SMILES | CC1CNCC(C)N1CCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O2S/c1-10-8-13-9-11(2)14(10)6-7-17(15,16)12(3,4)5/h10-11,13H,6-9H2,1-5H3 |
| InChIKey | NRLIPJQJYRYEHO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |