C13H28N2O2S — CID 106725692
[1-(2-tert-butylsulfonylethyl)-6-methylpiperidin-2-yl]methanamine (PubChem CID 106725692) has the molecular formula C13H28N2O2S and a molecular weight of 276.45 g/mol. Its IUPAC name is [1-(2-tert-butylsulfonylethyl)-6-methylpiperidin-2-yl]methanamine.
| Compound Name | [1-(2-tert-butylsulfonylethyl)-6-methylpiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 106725692 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | [1-(2-tert-butylsulfonylethyl)-6-methylpiperidin-2-yl]methanamine |
| SMILES | CC1CCCC(CN)N1CCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C13H28N2O2S/c1-11-6-5-7-12(10-14)15(11)8-9-18(16,17)13(2,3)4/h11-12H,5-10,14H2,1-4H3 |
| InChIKey | PXLYMIDIBQEVBI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |