C10H21N3O2S — CID 114810836
2-(aminomethyl)-N-cyclopropyl-6-methylpiperidine-1-sulfonamide (PubChem CID 114810836) has the molecular formula C10H21N3O2S and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N-cyclopropyl-6-methylpiperidine-1-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-cyclopropyl-6-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 114810836 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-(aminomethyl)-N-cyclopropyl-6-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCCC(CN)N1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C10H21N3O2S/c1-8-3-2-4-10(7-11)13(8)16(14,15)12-9-5-6-9/h8-10,12H,2-7,11H2,1H3 |
| InChIKey | PCHHIYJYARWBBI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |