C10H23ClN2 — CID 130616499
(2S,6R)-1-butyl-2,6-dimethylpiperazine;hydrochloride (PubChem CID 130616499) has the molecular formula C10H23ClN2 and a molecular weight of 206.76 g/mol. Its IUPAC name is (2S,6R)-1-butyl-2,6-dimethylpiperazine;hydrochloride.
| Compound Name | (2S,6R)-1-butyl-2,6-dimethylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 130616499 |
| Molecular Formula | C10H23ClN2 |
| Molecular Weight | 206.76 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (2S,6R)-1-butyl-2,6-dimethylpiperazine;hydrochloride |
| SMILES | CCCCN1[C@H](C)CNC[C@@H]1C.Cl |
| InChI | InChI=1S/C10H22N2.ClH/c1-4-5-6-12-9(2)7-11-8-10(12)3;/h9-11H,4-8H2,1-3H3;1H/t9-,10+; |
| InChIKey | RZSMMXDLDIAYOM-JMVWIVNTSA-N |
| XLogP | 1.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.76 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |