About 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one
2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one (PubChem CID 130718849) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one |
| PubChem CID | 130718849 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one |
| SMILES | CC(N)C(=O)N1C(C)CNCC1C |
| InChI | InChI=1S/C9H19N3O/c1-6-4-11-5-7(2)12(6)9(13)8(3)10/h6-8,11H,4-5,10H2,1-3H3 |
| InChIKey | REVVBUJHTSPWMK-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one?
The IUPAC name of 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one (CID 130718849) is 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one.
What is the SMILES notation for 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one?
The canonical SMILES for 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one is CC(N)C(=O)N1C(C)CNCC1C.
What is the InChIKey of 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one?
The InChIKey is REVVBUJHTSPWMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O/c1-6-4-11-5-7(2)12(6)9(13)8(3)10/h6-8,11H,4-5,10H2,1-3H3.
What are the key properties of 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one?
2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one has a molecular weight of 185.27 g/mol, XLogP of -0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2,6-dimethylpiperazin-1-yl)propan-1-one is sourced from PubChem (CID 130718849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).