About 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride
2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride (PubChem CID 130670860) has the molecular formula C8H18ClN3O
and a molecular weight of 207.70 g/mol. Its IUPAC name is 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride |
| PubChem CID | 130670860 |
| Molecular Formula | C8H18ClN3O |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride |
| SMILES | C[C@@H]1CNC[C@H](C)N1C(=O)CN.Cl |
| InChI | InChI=1S/C8H17N3O.ClH/c1-6-4-10-5-7(2)11(6)8(12)3-9;/h6-7,10H,3-5,9H2,1-2H3;1H/t6-,7+; |
| InChIKey | QMLIJFOGRIKDNH-UKMDXRBESA-N |
| XLogP | -0.42 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride?
The IUPAC name of 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride (CID 130670860) is 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride.
What is the SMILES notation for 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride?
The canonical SMILES for 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride is C[C@@H]1CNC[C@H](C)N1C(=O)CN.Cl.
What is the InChIKey of 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride?
The InChIKey is QMLIJFOGRIKDNH-UKMDXRBESA-N. The full InChI is InChI=1S/C8H17N3O.ClH/c1-6-4-10-5-7(2)11(6)8(12)3-9;/h6-7,10H,3-5,9H2,1-2H3;1H/t6-,7+;.
What are the key properties of 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride?
2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride has a molecular weight of 207.70 g/mol, XLogP of -0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[(2S,6R)-2,6-dimethylpiperazin-1-yl]ethanone;hydrochloride is sourced from PubChem (CID 130670860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).