C7H14N2O — CID 143975472
(2S)-2,6-dimethylpiperazine-1-carbaldehyde (PubChem CID 143975472) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is (2S)-2,6-dimethylpiperazine-1-carbaldehyde.
| Compound Name | (2S)-2,6-dimethylpiperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 143975472 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (2S)-2,6-dimethylpiperazine-1-carbaldehyde |
| SMILES | CC1CNC[C@H](C)N1C=O |
| InChI | InChI=1S/C7H14N2O/c1-6-3-8-4-7(2)9(6)5-10/h5-8H,3-4H2,1-2H3/t6-,7?/m0/s1 |
| InChIKey | QUZGBWFMQLHWNQ-PKPIPKONSA-N |
| XLogP | -0.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|