C10H23NO — CID 143696476
acetaldehyde;(3S,4R)-3,4-dimethylpyrrolidine;ethane (PubChem CID 143696476) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is acetaldehyde;(3S,4R)-3,4-dimethylpyrrolidine;ethane.
| Compound Name | acetaldehyde;(3S,4R)-3,4-dimethylpyrrolidine;ethane |
|---|---|
| PubChem CID | 143696476 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | acetaldehyde;(3S,4R)-3,4-dimethylpyrrolidine;ethane |
| SMILES | CC.CC=O.C[C@@H]1CNC[C@@H]1C |
| InChI | InChI=1S/C6H13N.C2H4O.C2H6/c1-5-3-7-4-6(5)2;1-2-3;1-2/h5-7H,3-4H2,1-2H3;2H,1H3;1-2H3/t5-,6+;; |
| InChIKey | KDLFGYDZXOZGCS-RUTFAPCESA-N |
| XLogP | 2.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|