About (3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride
(3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 122163647) has the molecular formula C6H12ClNO2
and a molecular weight of 165.62 g/mol. Its IUPAC name is (3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride.
Analyze (3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride?
The IUPAC name of (3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride (CID 122163647) is (3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride.
What is the SMILES notation for (3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride?
The canonical SMILES for (3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride is C[C@@H]1CNC[C@H]1C(=O)O.Cl.
What is the InChIKey of (3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride?
The InChIKey is GWZSHTKJOFTCDR-TYSVMGFPSA-N. The full InChI is InChI=1S/C6H11NO2.ClH/c1-4-2-7-3-5(4)6(8)9;/h4-5,7H,2-3H2,1H3,(H,8,9);1H/t4-,5-;/m1./s1.
What are the key properties of (3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride?
(3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride has a molecular weight of 165.62 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-methylpyrrolidine-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 122163647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).