About (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride
(3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride (PubChem CID 11424235) has the molecular formula C5H12Cl2N2O2
and a molecular weight of 203.07 g/mol. Its IUPAC name is (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride.
Molecular Properties
| Compound Name | (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride |
| PubChem CID | 11424235 |
| Molecular Formula | C5H12Cl2N2O2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.N[C@H]1CNC[C@@H]1C(=O)O |
| InChI | InChI=1S/C5H10N2O2.2ClH/c6-4-2-7-1-3(4)5(8)9;;/h3-4,7H,1-2,6H2,(H,8,9);2*1H/t3-,4-;;/m0../s1 |
| InChIKey | QAXWVSYJTFDUFI-RGVONZFCSA-N |
| XLogP | -0.54 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride?
The IUPAC name of (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride (CID 11424235) is (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride.
What is the SMILES notation for (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride?
The canonical SMILES for (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride is Cl.Cl.N[C@H]1CNC[C@@H]1C(=O)O.
What is the InChIKey of (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride?
The InChIKey is QAXWVSYJTFDUFI-RGVONZFCSA-N. The full InChI is InChI=1S/C5H10N2O2.2ClH/c6-4-2-7-1-3(4)5(8)9;;/h3-4,7H,1-2,6H2,(H,8,9);2*1H/t3-,4-;;/m0../s1.
What are the key properties of (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride?
(3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride has a molecular weight of 203.07 g/mol, XLogP of -0.54, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-aminopyrrolidine-3-carboxylic acid;dihydrochloride is sourced from PubChem (CID 11424235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).