(3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid

C8H13NO2 — CID 129369631

IUPAC(3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid
SMILESO=C(O)[C@@H]1CNC[C@@H]1C1CC1
InChIInChI=1S/C8H13NO2/c10-8(11)7-4-9-3-6(7)5-1-2-5/h5-7,9H,1-4H2,(H,10,11)/t6-,7-/m1/s1
InChIKeyFVSSNRDCBCSLGC-RNFRBKRXSA-N
MW155.20 g/mol
LogP0.32
Rot. Bonds2

About (3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid

(3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid (PubChem CID 129369631) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name(3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid
PubChem CID129369631
Molecular FormulaC8H13NO2
Molecular Weight155.20 g/mol
Exact Mass155.09
IUPAC Name(3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid
SMILESO=C(O)[C@@H]1CNC[C@@H]1C1CC1
InChIInChI=1S/C8H13NO2/c10-8(11)7-4-9-3-6(7)5-1-2-5/h5-7,9H,1-4H2,(H,10,11)/t6-,7-/m1/s1
InChIKeyFVSSNRDCBCSLGC-RNFRBKRXSA-N
XLogP0.32
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.20
LogP ≤ 50.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid?
The IUPAC name of (3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid (CID 129369631) is (3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for (3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid?
The canonical SMILES for (3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid is O=C(O)[C@@H]1CNC[C@@H]1C1CC1.
What is the InChIKey of (3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid?
The InChIKey is FVSSNRDCBCSLGC-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H13NO2/c10-8(11)7-4-9-3-6(7)5-1-2-5/h5-7,9H,1-4H2,(H,10,11)/t6-,7-/m1/s1.
What are the key properties of (3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid?
(3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid has a molecular weight of 155.20 g/mol, XLogP of 0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-cyclopropylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 129369631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).