C5H14Cl2N2 — CID 25178690
(3R,4S)-4-methylpyrrolidin-3-amine;dihydrochloride (PubChem CID 25178690) has the molecular formula C5H14Cl2N2 and a molecular weight of 173.09 g/mol. Its IUPAC name is (3R,4S)-4-methylpyrrolidin-3-amine;dihydrochloride.
| Compound Name | (3R,4S)-4-methylpyrrolidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 25178690 |
| Molecular Formula | C5H14Cl2N2 |
| Molecular Weight | 173.09 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | (3R,4S)-4-methylpyrrolidin-3-amine;dihydrochloride |
| SMILES | C[C@H]1CNC[C@@H]1N.Cl.Cl |
| InChI | InChI=1S/C5H12N2.2ClH/c1-4-2-7-3-5(4)6;;/h4-5,7H,2-3,6H2,1H3;2*1H/t4-,5-;;/m0../s1 |
| InChIKey | XHVYAOXNULEUHH-RSLHMRQOSA-N |
| XLogP | 0.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.09 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |