C5H10FN — CID 118447015
(3S,4S)-3-fluoro-4-methylpyrrolidine (PubChem CID 118447015) has the molecular formula C5H10FN and a molecular weight of 103.14 g/mol. Its IUPAC name is (3S,4S)-3-fluoro-4-methylpyrrolidine.
| Compound Name | (3S,4S)-3-fluoro-4-methylpyrrolidine |
|---|---|
| PubChem CID | 118447015 |
| Molecular Formula | C5H10FN |
| Molecular Weight | 103.14 g/mol |
| Exact Mass | 103.08 |
| IUPAC Name | (3S,4S)-3-fluoro-4-methylpyrrolidine |
| SMILES | C[C@H]1CNC[C@H]1F |
| InChI | InChI=1S/C5H10FN/c1-4-2-7-3-5(4)6/h4-5,7H,2-3H2,1H3/t4-,5+/m0/s1 |
| InChIKey | HPCFSOFBKLAFII-CRCLSJGQSA-N |
| XLogP | 0.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 103.14 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |