C8H15NO — CID 4643970
2,6-dimethylpiperidine-1-carbaldehyde (PubChem CID 4643970) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 2,6-dimethylpiperidine-1-carbaldehyde.
| Compound Name | 2,6-dimethylpiperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 4643970 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 2,6-dimethylpiperidine-1-carbaldehyde |
| SMILES | CC1CCCC(C)N1C=O |
| InChI | InChI=1S/C8H15NO/c1-7-4-3-5-8(2)9(7)6-10/h6-8H,3-5H2,1-2H3 |
| InChIKey | ZZSRDYOYTXLWMU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|