C7H16BrNSi — CID 140711295
bromo-(2,6-dimethylpiperidin-1-yl)silane (PubChem CID 140711295) has the molecular formula C7H16BrNSi and a molecular weight of 222.20 g/mol. Its IUPAC name is bromo-(2,6-dimethylpiperidin-1-yl)silane.
| Compound Name | bromo-(2,6-dimethylpiperidin-1-yl)silane |
|---|---|
| PubChem CID | 140711295 |
| Molecular Formula | C7H16BrNSi |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | bromo-(2,6-dimethylpiperidin-1-yl)silane |
| SMILES | CC1CCCC(C)N1[SiH2]Br |
| InChI | InChI=1S/C7H16BrNSi/c1-6-4-3-5-7(2)9(6)10-8/h6-7H,3-5,10H2,1-2H3 |
| InChIKey | OMVDAGQPDSDDIR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|