C9H19Cl2N — CID 139755409
1-(1-chloroethyl)-2,6-dimethylpiperidine;hydrochloride (PubChem CID 139755409) has the molecular formula C9H19Cl2N and a molecular weight of 212.16 g/mol. Its IUPAC name is 1-(1-chloroethyl)-2,6-dimethylpiperidine;hydrochloride.
| Compound Name | 1-(1-chloroethyl)-2,6-dimethylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 139755409 |
| Molecular Formula | C9H19Cl2N |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 1-(1-chloroethyl)-2,6-dimethylpiperidine;hydrochloride |
| SMILES | CC(Cl)N1C(C)CCCC1C.Cl |
| InChI | InChI=1S/C9H18ClN.ClH/c1-7-5-4-6-8(2)11(7)9(3)10;/h7-9H,4-6H2,1-3H3;1H |
| InChIKey | RGTGPIKUDBETPG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|